C12H17BrCl2N2O2S — CID 4967816
4-bromo-2,6-dichloro-N-[2-(diethylamino)ethyl]benzenesulfonamide (PubChem CID 4967816) has the molecular formula C12H17BrCl2N2O2S and a molecular weight of 404.16 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-[2-(diethylamino)ethyl]benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-[2-(diethylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4967816 |
| Molecular Formula | C12H17BrCl2N2O2S |
| Molecular Weight | 404.16 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-[2-(diethylamino)ethyl]benzenesulfonamide |
| SMILES | CCN(CC)CCNS(=O)(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C12H17BrCl2N2O2S/c1-3-17(4-2)6-5-16-20(18,19)12-10(14)7-9(13)8-11(12)15/h7-8,16H,3-6H2,1-2H3 |
| InChIKey | JLGQLUOOTBBHQM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.16 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |