C10H13BrCl2N2O2S — CID 43605913
4-bromo-2,6-dichloro-N-[3-(methylamino)propyl]benzenesulfonamide (PubChem CID 43605913) has the molecular formula C10H13BrCl2N2O2S and a molecular weight of 376.10 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-[3-(methylamino)propyl]benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-[3-(methylamino)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43605913 |
| Molecular Formula | C10H13BrCl2N2O2S |
| Molecular Weight | 376.10 g/mol |
| Exact Mass | 373.93 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-[3-(methylamino)propyl]benzenesulfonamide |
| SMILES | CNCCCNS(=O)(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C10H13BrCl2N2O2S/c1-14-3-2-4-15-18(16,17)10-8(12)5-7(11)6-9(10)13/h5-6,14-15H,2-4H2,1H3 |
| InChIKey | AWHUWGQWLCLBOO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.10 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|