C13H18BrCl2NO2S — CID 83147534
4-bromo-2,6-dichloro-N-(2,3,3-trimethylbutyl)benzenesulfonamide (PubChem CID 83147534) has the molecular formula C13H18BrCl2NO2S and a molecular weight of 403.17 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(2,3,3-trimethylbutyl)benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-(2,3,3-trimethylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 83147534 |
| Molecular Formula | C13H18BrCl2NO2S |
| Molecular Weight | 403.17 g/mol |
| Exact Mass | 400.96 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(2,3,3-trimethylbutyl)benzenesulfonamide |
| SMILES | CC(CNS(=O)(=O)c1c(Cl)cc(Br)cc1Cl)C(C)(C)C |
| InChI | InChI=1S/C13H18BrCl2NO2S/c1-8(13(2,3)4)7-17-20(18,19)12-10(15)5-9(14)6-11(12)16/h5-6,8,17H,7H2,1-4H3 |
| InChIKey | AGQODLOPWCEKJR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.17 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |