C10H12BrCl2NO3S — CID 82723965
4-bromo-2,6-dichloro-N-[(2-methylpropan-2-yl)oxy]benzenesulfonamide (PubChem CID 82723965) has the molecular formula C10H12BrCl2NO3S and a molecular weight of 377.09 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-[(2-methylpropan-2-yl)oxy]benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-[(2-methylpropan-2-yl)oxy]benzenesulfonamide |
|---|---|
| PubChem CID | 82723965 |
| Molecular Formula | C10H12BrCl2NO3S |
| Molecular Weight | 377.09 g/mol |
| Exact Mass | 374.91 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-[(2-methylpropan-2-yl)oxy]benzenesulfonamide |
| SMILES | CC(C)(C)ONS(=O)(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C10H12BrCl2NO3S/c1-10(2,3)17-14-18(15,16)9-7(12)4-6(11)5-8(9)13/h4-5,14H,1-3H3 |
| InChIKey | AZGPYSWYYLDPFI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.09 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|