C8H6BrCl2NO5S — CID 60661245
2-[(4-bromo-2,6-dichlorophenyl)sulfonylamino]oxyacetic acid (PubChem CID 60661245) has the molecular formula C8H6BrCl2NO5S and a molecular weight of 379.02 g/mol. Its IUPAC name is 2-[(4-bromo-2,6-dichlorophenyl)sulfonylamino]oxyacetic acid.
| Compound Name | 2-[(4-bromo-2,6-dichlorophenyl)sulfonylamino]oxyacetic acid |
|---|---|
| PubChem CID | 60661245 |
| Molecular Formula | C8H6BrCl2NO5S |
| Molecular Weight | 379.02 g/mol |
| Exact Mass | 376.85 |
| IUPAC Name | 2-[(4-bromo-2,6-dichlorophenyl)sulfonylamino]oxyacetic acid |
| SMILES | O=C(O)CONS(=O)(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C8H6BrCl2NO5S/c9-4-1-5(10)8(6(11)2-4)18(15,16)12-17-3-7(13)14/h1-2,12H,3H2,(H,13,14) |
| InChIKey | ROQAWSIFRDPELM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.02 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|