C6H5Br2NO5S2 — CID 60661178
2-[(2,5-dibromothiophen-3-yl)sulfonylamino]oxyacetic acid (PubChem CID 60661178) has the molecular formula C6H5Br2NO5S2 and a molecular weight of 395.05 g/mol. Its IUPAC name is 2-[(2,5-dibromothiophen-3-yl)sulfonylamino]oxyacetic acid.
| Compound Name | 2-[(2,5-dibromothiophen-3-yl)sulfonylamino]oxyacetic acid |
|---|---|
| PubChem CID | 60661178 |
| Molecular Formula | C6H5Br2NO5S2 |
| Molecular Weight | 395.05 g/mol |
| Exact Mass | 392.80 |
| IUPAC Name | 2-[(2,5-dibromothiophen-3-yl)sulfonylamino]oxyacetic acid |
| SMILES | O=C(O)CONS(=O)(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C6H5Br2NO5S2/c7-4-1-3(6(8)15-4)16(12,13)9-14-2-5(10)11/h1,9H,2H2,(H,10,11) |
| InChIKey | QWXCADAYNKQHMN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.05 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|