C10H13Br2NO4S2 — CID 82683979
5-[(2,5-dibromothiophen-3-yl)sulfonylamino]-4-methylpentanoic acid (PubChem CID 82683979) has the molecular formula C10H13Br2NO4S2 and a molecular weight of 435.16 g/mol. Its IUPAC name is 5-[(2,5-dibromothiophen-3-yl)sulfonylamino]-4-methylpentanoic acid.
| Compound Name | 5-[(2,5-dibromothiophen-3-yl)sulfonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 82683979 |
| Molecular Formula | C10H13Br2NO4S2 |
| Molecular Weight | 435.16 g/mol |
| Exact Mass | 432.87 |
| IUPAC Name | 5-[(2,5-dibromothiophen-3-yl)sulfonylamino]-4-methylpentanoic acid |
| SMILES | CC(CCC(=O)O)CNS(=O)(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C10H13Br2NO4S2/c1-6(2-3-9(14)15)5-13-19(16,17)7-4-8(11)18-10(7)12/h4,6,13H,2-3,5H2,1H3,(H,14,15) |
| InChIKey | OURFUQKFAJDPHL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.16 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |