C11H16BrNO4S2 — CID 82683810
5-[(5-bromo-2-methylthiophen-3-yl)sulfonylamino]-4-methylpentanoic acid (PubChem CID 82683810) has the molecular formula C11H16BrNO4S2 and a molecular weight of 370.29 g/mol. Its IUPAC name is 5-[(5-bromo-2-methylthiophen-3-yl)sulfonylamino]-4-methylpentanoic acid.
| Compound Name | 5-[(5-bromo-2-methylthiophen-3-yl)sulfonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 82683810 |
| Molecular Formula | C11H16BrNO4S2 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | 5-[(5-bromo-2-methylthiophen-3-yl)sulfonylamino]-4-methylpentanoic acid |
| SMILES | Cc1sc(Br)cc1S(=O)(=O)NCC(C)CCC(=O)O |
| InChI | InChI=1S/C11H16BrNO4S2/c1-7(3-4-11(14)15)6-13-19(16,17)9-5-10(12)18-8(9)2/h5,7,13H,3-4,6H2,1-2H3,(H,14,15) |
| InChIKey | WOOICQGHGQTYBW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |