C9H16BrClN2O2S2 — CID 120825128
5-bromo-2-methyl-N-[2-(methylamino)propyl]thiophene-3-sulfonamide;hydrochloride (PubChem CID 120825128) has the molecular formula C9H16BrClN2O2S2 and a molecular weight of 363.73 g/mol. Its IUPAC name is 5-bromo-2-methyl-N-[2-(methylamino)propyl]thiophene-3-sulfonamide;hydrochloride.
| Compound Name | 5-bromo-2-methyl-N-[2-(methylamino)propyl]thiophene-3-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120825128 |
| Molecular Formula | C9H16BrClN2O2S2 |
| Molecular Weight | 363.73 g/mol |
| Exact Mass | 361.95 |
| IUPAC Name | 5-bromo-2-methyl-N-[2-(methylamino)propyl]thiophene-3-sulfonamide;hydrochloride |
| SMILES | CNC(C)CNS(=O)(=O)c1cc(Br)sc1C.Cl |
| InChI | InChI=1S/C9H15BrN2O2S2.ClH/c1-6(11-3)5-12-16(13,14)8-4-9(10)15-7(8)2;/h4,6,11-12H,5H2,1-3H3;1H |
| InChIKey | GBMXCJHDGKINBX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.73 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |