C10H16BrNO2S3 — CID 115690352
5-bromo-2-methyl-N-(3-methylsulfanylbutyl)thiophene-3-sulfonamide (PubChem CID 115690352) has the molecular formula C10H16BrNO2S3 and a molecular weight of 358.35 g/mol. Its IUPAC name is 5-bromo-2-methyl-N-(3-methylsulfanylbutyl)thiophene-3-sulfonamide.
| Compound Name | 5-bromo-2-methyl-N-(3-methylsulfanylbutyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 115690352 |
| Molecular Formula | C10H16BrNO2S3 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 356.95 |
| IUPAC Name | 5-bromo-2-methyl-N-(3-methylsulfanylbutyl)thiophene-3-sulfonamide |
| SMILES | CSC(C)CCNS(=O)(=O)c1cc(Br)sc1C |
| InChI | InChI=1S/C10H16BrNO2S3/c1-7(15-3)4-5-12-17(13,14)9-6-10(11)16-8(9)2/h6-7,12H,4-5H2,1-3H3 |
| InChIKey | GZUFRRMCPXIOGV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |