C11H16BrNO2S2 — CID 115690369
5-bromo-N-(3-cyclopropylpropyl)-2-methylthiophene-3-sulfonamide (PubChem CID 115690369) has the molecular formula C11H16BrNO2S2 and a molecular weight of 338.29 g/mol. Its IUPAC name is 5-bromo-N-(3-cyclopropylpropyl)-2-methylthiophene-3-sulfonamide.
| Compound Name | 5-bromo-N-(3-cyclopropylpropyl)-2-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 115690369 |
| Molecular Formula | C11H16BrNO2S2 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | 5-bromo-N-(3-cyclopropylpropyl)-2-methylthiophene-3-sulfonamide |
| SMILES | Cc1sc(Br)cc1S(=O)(=O)NCCCC1CC1 |
| InChI | InChI=1S/C11H16BrNO2S2/c1-8-10(7-11(12)16-8)17(14,15)13-6-2-3-9-4-5-9/h7,9,13H,2-6H2,1H3 |
| InChIKey | RJDBUVMJHOVWOL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|