C10H18BrClN2O2S2 — CID 120716056
5-bromo-2-methyl-N-[2-(propylamino)ethyl]thiophene-3-sulfonamide;hydrochloride (PubChem CID 120716056) has the molecular formula C10H18BrClN2O2S2 and a molecular weight of 377.76 g/mol. Its IUPAC name is 5-bromo-2-methyl-N-[2-(propylamino)ethyl]thiophene-3-sulfonamide;hydrochloride.
| Compound Name | 5-bromo-2-methyl-N-[2-(propylamino)ethyl]thiophene-3-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120716056 |
| Molecular Formula | C10H18BrClN2O2S2 |
| Molecular Weight | 377.76 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | 5-bromo-2-methyl-N-[2-(propylamino)ethyl]thiophene-3-sulfonamide;hydrochloride |
| SMILES | CCCNCCNS(=O)(=O)c1cc(Br)sc1C.Cl |
| InChI | InChI=1S/C10H17BrN2O2S2.ClH/c1-3-4-12-5-6-13-17(14,15)9-7-10(11)16-8(9)2;/h7,12-13H,3-6H2,1-2H3;1H |
| InChIKey | PEGAUPXOECXJFA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.76 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|