C12H20BrClN2O2S — CID 120716139
3-bromo-2-methyl-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride (PubChem CID 120716139) has the molecular formula C12H20BrClN2O2S and a molecular weight of 371.73 g/mol. Its IUPAC name is 3-bromo-2-methyl-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | 3-bromo-2-methyl-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120716139 |
| Molecular Formula | C12H20BrClN2O2S |
| Molecular Weight | 371.73 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | 3-bromo-2-methyl-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride |
| SMILES | CCCNCCNS(=O)(=O)c1cccc(Br)c1C.Cl |
| InChI | InChI=1S/C12H19BrN2O2S.ClH/c1-3-7-14-8-9-15-18(16,17)12-6-4-5-11(13)10(12)2;/h4-6,14-15H,3,7-9H2,1-2H3;1H |
| InChIKey | CUCFNXPYWGJOKF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.73 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|