C10H16BrClN2O2S — CID 119973933
2-bromo-N-[2-(ethylamino)ethyl]benzenesulfonamide;hydrochloride (PubChem CID 119973933) has the molecular formula C10H16BrClN2O2S and a molecular weight of 343.67 g/mol. Its IUPAC name is 2-bromo-N-[2-(ethylamino)ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | 2-bromo-N-[2-(ethylamino)ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119973933 |
| Molecular Formula | C10H16BrClN2O2S |
| Molecular Weight | 343.67 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | 2-bromo-N-[2-(ethylamino)ethyl]benzenesulfonamide;hydrochloride |
| SMILES | CCNCCNS(=O)(=O)c1ccccc1Br.Cl |
| InChI | InChI=1S/C10H15BrN2O2S.ClH/c1-2-12-7-8-13-16(14,15)10-6-4-3-5-9(10)11;/h3-6,12-13H,2,7-8H2,1H3;1H |
| InChIKey | KBBAJWVTFYXDJN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.67 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|