C13H22BrClN2O3S — CID 120715849
5-bromo-2-methoxy-4-methyl-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride (PubChem CID 120715849) has the molecular formula C13H22BrClN2O3S and a molecular weight of 401.75 g/mol. Its IUPAC name is 5-bromo-2-methoxy-4-methyl-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | 5-bromo-2-methoxy-4-methyl-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120715849 |
| Molecular Formula | C13H22BrClN2O3S |
| Molecular Weight | 401.75 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | 5-bromo-2-methoxy-4-methyl-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride |
| SMILES | CCCNCCNS(=O)(=O)c1cc(Br)c(C)cc1OC.Cl |
| InChI | InChI=1S/C13H21BrN2O3S.ClH/c1-4-5-15-6-7-16-20(17,18)13-9-11(14)10(2)8-12(13)19-3;/h8-9,15-16H,4-7H2,1-3H3;1H |
| InChIKey | LXRHZWHFUCSDKZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.75 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|