C14H25ClN2O5S — CID 120717418
4,5-dimethoxy-N-[2-(2-methoxyethylamino)ethyl]-2-methylbenzenesulfonamide;hydrochloride (PubChem CID 120717418) has the molecular formula C14H25ClN2O5S and a molecular weight of 368.88 g/mol. Its IUPAC name is 4,5-dimethoxy-N-[2-(2-methoxyethylamino)ethyl]-2-methylbenzenesulfonamide;hydrochloride.
| Compound Name | 4,5-dimethoxy-N-[2-(2-methoxyethylamino)ethyl]-2-methylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120717418 |
| Molecular Formula | C14H25ClN2O5S |
| Molecular Weight | 368.88 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 4,5-dimethoxy-N-[2-(2-methoxyethylamino)ethyl]-2-methylbenzenesulfonamide;hydrochloride |
| SMILES | COCCNCCNS(=O)(=O)c1cc(OC)c(OC)cc1C.Cl |
| InChI | InChI=1S/C14H24N2O5S.ClH/c1-11-9-12(20-3)13(21-4)10-14(11)22(17,18)16-6-5-15-7-8-19-2;/h9-10,15-16H,5-8H2,1-4H3;1H |
| InChIKey | HBEUYYIJPQXZDT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.88 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|