C12H19NO4S — CID 15943934
4-methoxy-N-(2-methoxyethyl)-2,5-dimethylbenzenesulfonamide (PubChem CID 15943934) has the molecular formula C12H19NO4S and a molecular weight of 273.35 g/mol. Its IUPAC name is 4-methoxy-N-(2-methoxyethyl)-2,5-dimethylbenzenesulfonamide.
| Compound Name | 4-methoxy-N-(2-methoxyethyl)-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 15943934 |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 4-methoxy-N-(2-methoxyethyl)-2,5-dimethylbenzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1cc(C)c(OC)cc1C |
| InChI | InChI=1S/C12H19NO4S/c1-9-8-12(10(2)7-11(9)17-4)18(14,15)13-5-6-16-3/h7-8,13H,5-6H2,1-4H3 |
| InChIKey | HSDYYQQJLSOKDB-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|