C11H18N2O3S — CID 29054263
2-amino-N-(2-methoxyethyl)-4,5-dimethylbenzenesulfonamide (PubChem CID 29054263) has the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. Its IUPAC name is 2-amino-N-(2-methoxyethyl)-4,5-dimethylbenzenesulfonamide.
| Compound Name | 2-amino-N-(2-methoxyethyl)-4,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 29054263 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2-amino-N-(2-methoxyethyl)-4,5-dimethylbenzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1cc(C)c(C)cc1N |
| InChI | InChI=1S/C11H18N2O3S/c1-8-6-10(12)11(7-9(8)2)17(14,15)13-4-5-16-3/h6-7,13H,4-5,12H2,1-3H3 |
| InChIKey | AXKRHLLCUBYKSS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|