C11H16FNO5S — CID 35320406
2-fluoro-4,5-dimethoxy-N-(2-methoxyethyl)benzenesulfonamide (PubChem CID 35320406) has the molecular formula C11H16FNO5S and a molecular weight of 293.32 g/mol. Its IUPAC name is 2-fluoro-4,5-dimethoxy-N-(2-methoxyethyl)benzenesulfonamide.
| Compound Name | 2-fluoro-4,5-dimethoxy-N-(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 35320406 |
| Molecular Formula | C11H16FNO5S |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2-fluoro-4,5-dimethoxy-N-(2-methoxyethyl)benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1cc(OC)c(OC)cc1F |
| InChI | InChI=1S/C11H16FNO5S/c1-16-5-4-13-19(14,15)11-7-10(18-3)9(17-2)6-8(11)12/h6-7,13H,4-5H2,1-3H3 |
| InChIKey | XISVMQKRMZBLBQ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|