C12H19FN2O4S — CID 43605994
2-fluoro-4,5-dimethoxy-N-[3-(methylamino)propyl]benzenesulfonamide (PubChem CID 43605994) has the molecular formula C12H19FN2O4S and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-fluoro-4,5-dimethoxy-N-[3-(methylamino)propyl]benzenesulfonamide.
| Compound Name | 2-fluoro-4,5-dimethoxy-N-[3-(methylamino)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43605994 |
| Molecular Formula | C12H19FN2O4S |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-fluoro-4,5-dimethoxy-N-[3-(methylamino)propyl]benzenesulfonamide |
| SMILES | CNCCCNS(=O)(=O)c1cc(OC)c(OC)cc1F |
| InChI | InChI=1S/C12H19FN2O4S/c1-14-5-4-6-15-20(16,17)12-8-11(19-3)10(18-2)7-9(12)13/h7-8,14-15H,4-6H2,1-3H3 |
| InChIKey | UXDICESUYDCZPM-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|