C12H20BrClN2O4S — CID 120707315
4-bromo-2,5-dimethoxy-N-[3-(methylamino)propyl]benzenesulfonamide;hydrochloride (PubChem CID 120707315) has the molecular formula C12H20BrClN2O4S and a molecular weight of 403.73 g/mol. Its IUPAC name is 4-bromo-2,5-dimethoxy-N-[3-(methylamino)propyl]benzenesulfonamide;hydrochloride.
| Compound Name | 4-bromo-2,5-dimethoxy-N-[3-(methylamino)propyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120707315 |
| Molecular Formula | C12H20BrClN2O4S |
| Molecular Weight | 403.73 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | 4-bromo-2,5-dimethoxy-N-[3-(methylamino)propyl]benzenesulfonamide;hydrochloride |
| SMILES | CNCCCNS(=O)(=O)c1cc(OC)c(Br)cc1OC.Cl |
| InChI | InChI=1S/C12H19BrN2O4S.ClH/c1-14-5-4-6-15-20(16,17)12-8-10(18-2)9(13)7-11(12)19-3;/h7-8,14-15H,4-6H2,1-3H3;1H |
| InChIKey | IEDGZOVWRJETJV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.73 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|