C10H12BrF2NO3S — CID 75451292
4-bromo-5-fluoro-N-(3-fluoropropyl)-2-methoxybenzenesulfonamide (PubChem CID 75451292) has the molecular formula C10H12BrF2NO3S and a molecular weight of 344.18 g/mol. Its IUPAC name is 4-bromo-5-fluoro-N-(3-fluoropropyl)-2-methoxybenzenesulfonamide.
| Compound Name | 4-bromo-5-fluoro-N-(3-fluoropropyl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 75451292 |
| Molecular Formula | C10H12BrF2NO3S |
| Molecular Weight | 344.18 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | 4-bromo-5-fluoro-N-(3-fluoropropyl)-2-methoxybenzenesulfonamide |
| SMILES | COc1cc(Br)c(F)cc1S(=O)(=O)NCCCF |
| InChI | InChI=1S/C10H12BrF2NO3S/c1-17-9-5-7(11)8(13)6-10(9)18(15,16)14-4-2-3-12/h5-6,14H,2-4H2,1H3 |
| InChIKey | WFJIVWKIKIYOIA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.18 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|