C12H20BrClN2O3S — CID 120583356
N-(4-aminobutyl)-5-bromo-2-methoxy-4-methylbenzenesulfonamide;hydrochloride (PubChem CID 120583356) has the molecular formula C12H20BrClN2O3S and a molecular weight of 387.73 g/mol. Its IUPAC name is N-(4-aminobutyl)-5-bromo-2-methoxy-4-methylbenzenesulfonamide;hydrochloride.
| Compound Name | N-(4-aminobutyl)-5-bromo-2-methoxy-4-methylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120583356 |
| Molecular Formula | C12H20BrClN2O3S |
| Molecular Weight | 387.73 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | N-(4-aminobutyl)-5-bromo-2-methoxy-4-methylbenzenesulfonamide;hydrochloride |
| SMILES | COc1cc(C)c(Br)cc1S(=O)(=O)NCCCCN.Cl |
| InChI | InChI=1S/C12H19BrN2O3S.ClH/c1-9-7-11(18-2)12(8-10(9)13)19(16,17)15-6-4-3-5-14;/h7-8,15H,3-6,14H2,1-2H3;1H |
| InChIKey | RCWBAKFZSRHYKD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.73 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|