C13H16FN3O4S — CID 35309403
2-fluoro-N-(2-imidazol-1-ylethyl)-4,5-dimethoxybenzenesulfonamide (PubChem CID 35309403) has the molecular formula C13H16FN3O4S and a molecular weight of 329.35 g/mol. Its IUPAC name is 2-fluoro-N-(2-imidazol-1-ylethyl)-4,5-dimethoxybenzenesulfonamide.
| Compound Name | 2-fluoro-N-(2-imidazol-1-ylethyl)-4,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 35309403 |
| Molecular Formula | C13H16FN3O4S |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 2-fluoro-N-(2-imidazol-1-ylethyl)-4,5-dimethoxybenzenesulfonamide |
| SMILES | COc1cc(F)c(S(=O)(=O)NCCn2ccnc2)cc1OC |
| InChI | InChI=1S/C13H16FN3O4S/c1-20-11-7-10(14)13(8-12(11)21-2)22(18,19)16-4-6-17-5-3-15-9-17/h3,5,7-9,16H,4,6H2,1-2H3 |
| InChIKey | PSYXULFEDZSRJG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |