C13H18N4O2S — CID 61326120
5-amino-2-ethyl-N-(2-imidazol-1-ylethyl)benzenesulfonamide (PubChem CID 61326120) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is 5-amino-2-ethyl-N-(2-imidazol-1-ylethyl)benzenesulfonamide.
| Compound Name | 5-amino-2-ethyl-N-(2-imidazol-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61326120 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 5-amino-2-ethyl-N-(2-imidazol-1-ylethyl)benzenesulfonamide |
| SMILES | CCc1ccc(N)cc1S(=O)(=O)NCCn1ccnc1 |
| InChI | InChI=1S/C13H18N4O2S/c1-2-11-3-4-12(14)9-13(11)20(18,19)16-6-8-17-7-5-15-10-17/h3-5,7,9-10,16H,2,6,8,14H2,1H3 |
| InChIKey | ZVLXDWPINMSGFT-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|