C14H20N4O2S — CID 28993569
5-amino-N-(3-imidazol-1-ylpropyl)-2,3-dimethylbenzenesulfonamide (PubChem CID 28993569) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 5-amino-N-(3-imidazol-1-ylpropyl)-2,3-dimethylbenzenesulfonamide.
| Compound Name | 5-amino-N-(3-imidazol-1-ylpropyl)-2,3-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 28993569 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 5-amino-N-(3-imidazol-1-ylpropyl)-2,3-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(N)cc(S(=O)(=O)NCCCn2ccnc2)c1C |
| InChI | InChI=1S/C14H20N4O2S/c1-11-8-13(15)9-14(12(11)2)21(19,20)17-4-3-6-18-7-5-16-10-18/h5,7-10,17H,3-4,6,15H2,1-2H3 |
| InChIKey | AMUCKVWHGFHUIB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|