C20H23N3O4S2 — CID 57430295
5-(benzenesulfonyl)-N-(3-imidazol-1-ylpropyl)-2,3-dimethylbenzenesulfonamide (PubChem CID 57430295) has the molecular formula C20H23N3O4S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-N-(3-imidazol-1-ylpropyl)-2,3-dimethylbenzenesulfonamide.
| Compound Name | 5-(benzenesulfonyl)-N-(3-imidazol-1-ylpropyl)-2,3-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 57430295 |
| Molecular Formula | C20H23N3O4S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 5-(benzenesulfonyl)-N-(3-imidazol-1-ylpropyl)-2,3-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)c2ccccc2)cc(S(=O)(=O)NCCCn2ccnc2)c1C |
| InChI | InChI=1S/C20H23N3O4S2/c1-16-13-19(28(24,25)18-7-4-3-5-8-18)14-20(17(16)2)29(26,27)22-9-6-11-23-12-10-21-15-23/h3-5,7-8,10,12-15,22H,6,9,11H2,1-2H3 |
| InChIKey | SWISUGFAUDYVPR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|