C19H19Cl2N3O4S2 — CID 57430299
5-(2,3-dichlorophenyl)sulfonyl-N-(3-imidazol-1-ylpropyl)-2-methylbenzenesulfonamide (PubChem CID 57430299) has the molecular formula C19H19Cl2N3O4S2 and a molecular weight of 488.42 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)sulfonyl-N-(3-imidazol-1-ylpropyl)-2-methylbenzenesulfonamide.
| Compound Name | 5-(2,3-dichlorophenyl)sulfonyl-N-(3-imidazol-1-ylpropyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 57430299 |
| Molecular Formula | C19H19Cl2N3O4S2 |
| Molecular Weight | 488.42 g/mol |
| Exact Mass | 487.02 |
| IUPAC Name | 5-(2,3-dichlorophenyl)sulfonyl-N-(3-imidazol-1-ylpropyl)-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)c2cccc(Cl)c2Cl)cc1S(=O)(=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C19H19Cl2N3O4S2/c1-14-6-7-15(29(25,26)17-5-2-4-16(20)19(17)21)12-18(14)30(27,28)23-8-3-10-24-11-9-22-13-24/h2,4-7,9,11-13,23H,3,8,10H2,1H3 |
| InChIKey | DEZPNJAZLIISMH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|