C13H15Br2N3O2S — CID 81427897
2,5-dibromo-N-(3-imidazol-1-ylpropyl)-4-methylbenzenesulfonamide (PubChem CID 81427897) has the molecular formula C13H15Br2N3O2S and a molecular weight of 437.16 g/mol. Its IUPAC name is 2,5-dibromo-N-(3-imidazol-1-ylpropyl)-4-methylbenzenesulfonamide.
| Compound Name | 2,5-dibromo-N-(3-imidazol-1-ylpropyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 81427897 |
| Molecular Formula | C13H15Br2N3O2S |
| Molecular Weight | 437.16 g/mol |
| Exact Mass | 434.93 |
| IUPAC Name | 2,5-dibromo-N-(3-imidazol-1-ylpropyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1cc(Br)c(S(=O)(=O)NCCCn2ccnc2)cc1Br |
| InChI | InChI=1S/C13H15Br2N3O2S/c1-10-7-12(15)13(8-11(10)14)21(19,20)17-3-2-5-18-6-4-16-9-18/h4,6-9,17H,2-3,5H2,1H3 |
| InChIKey | FFAZAPKTWCGSMN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.16 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|