C13H15BrFN3O2S — CID 61069449
2-bromo-4-fluoro-N-(4-imidazol-1-ylbutyl)benzenesulfonamide (PubChem CID 61069449) has the molecular formula C13H15BrFN3O2S and a molecular weight of 376.25 g/mol. Its IUPAC name is 2-bromo-4-fluoro-N-(4-imidazol-1-ylbutyl)benzenesulfonamide.
| Compound Name | 2-bromo-4-fluoro-N-(4-imidazol-1-ylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61069449 |
| Molecular Formula | C13H15BrFN3O2S |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 2-bromo-4-fluoro-N-(4-imidazol-1-ylbutyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCCCn1ccnc1)c1ccc(F)cc1Br |
| InChI | InChI=1S/C13H15BrFN3O2S/c14-12-9-11(15)3-4-13(12)21(19,20)17-5-1-2-7-18-8-6-16-10-18/h3-4,6,8-10,17H,1-2,5,7H2 |
| InChIKey | SKYVKSVWANHAAQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|