C12H15FN4O2S — CID 106018063
2-(aminomethyl)-5-fluoro-N-(2-imidazol-1-ylethyl)benzenesulfonamide (PubChem CID 106018063) has the molecular formula C12H15FN4O2S and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-(aminomethyl)-5-fluoro-N-(2-imidazol-1-ylethyl)benzenesulfonamide.
| Compound Name | 2-(aminomethyl)-5-fluoro-N-(2-imidazol-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106018063 |
| Molecular Formula | C12H15FN4O2S |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-(aminomethyl)-5-fluoro-N-(2-imidazol-1-ylethyl)benzenesulfonamide |
| SMILES | NCc1ccc(F)cc1S(=O)(=O)NCCn1ccnc1 |
| InChI | InChI=1S/C12H15FN4O2S/c13-11-2-1-10(8-14)12(7-11)20(18,19)16-4-6-17-5-3-15-9-17/h1-3,5,7,9,16H,4,6,8,14H2 |
| InChIKey | LLGCMRBZRHQYRU-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |