C10H14N4O2S2 — CID 54951556
5-(aminomethyl)-N-(2-imidazol-1-ylethyl)thiophene-2-sulfonamide (PubChem CID 54951556) has the molecular formula C10H14N4O2S2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2-imidazol-1-ylethyl)thiophene-2-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(2-imidazol-1-ylethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 54951556 |
| Molecular Formula | C10H14N4O2S2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 5-(aminomethyl)-N-(2-imidazol-1-ylethyl)thiophene-2-sulfonamide |
| SMILES | NCc1ccc(S(=O)(=O)NCCn2ccnc2)s1 |
| InChI | InChI=1S/C10H14N4O2S2/c11-7-9-1-2-10(17-9)18(15,16)13-4-6-14-5-3-12-8-14/h1-3,5,8,13H,4,6-7,11H2 |
| InChIKey | MATZZQGMBQXOAP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |