C10H12N4O2S3 — CID 106270612
5-(2-imidazol-1-ylethylsulfamoyl)thiophene-2-carbothioamide (PubChem CID 106270612) has the molecular formula C10H12N4O2S3 and a molecular weight of 316.43 g/mol. Its IUPAC name is 5-(2-imidazol-1-ylethylsulfamoyl)thiophene-2-carbothioamide.
| Compound Name | 5-(2-imidazol-1-ylethylsulfamoyl)thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 106270612 |
| Molecular Formula | C10H12N4O2S3 |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 5-(2-imidazol-1-ylethylsulfamoyl)thiophene-2-carbothioamide |
| SMILES | NC(=S)c1ccc(S(=O)(=O)NCCn2ccnc2)s1 |
| InChI | InChI=1S/C10H12N4O2S3/c11-10(17)8-1-2-9(18-8)19(15,16)13-4-6-14-5-3-12-7-14/h1-3,5,7,13H,4,6H2,(H2,11,17) |
| InChIKey | CMSXOPUSAHSRPZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|