C13H23N3O2S3 — CID 106270991
5-[4-[methyl(propan-2-yl)amino]butylsulfamoyl]thiophene-2-carbothioamide (PubChem CID 106270991) has the molecular formula C13H23N3O2S3 and a molecular weight of 349.55 g/mol. Its IUPAC name is 5-[4-[methyl(propan-2-yl)amino]butylsulfamoyl]thiophene-2-carbothioamide.
| Compound Name | 5-[4-[methyl(propan-2-yl)amino]butylsulfamoyl]thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 106270991 |
| Molecular Formula | C13H23N3O2S3 |
| Molecular Weight | 349.55 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 5-[4-[methyl(propan-2-yl)amino]butylsulfamoyl]thiophene-2-carbothioamide |
| SMILES | CC(C)N(C)CCCCNS(=O)(=O)c1ccc(C(N)=S)s1 |
| InChI | InChI=1S/C13H23N3O2S3/c1-10(2)16(3)9-5-4-8-15-21(17,18)12-7-6-11(20-12)13(14)19/h6-7,10,15H,4-5,8-9H2,1-3H3,(H2,14,19) |
| InChIKey | XCCFEPMGANGQLL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.55 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|