C10H14N2O4S3 — CID 106270997
ethyl 3-[(5-carbamothioylthiophen-2-yl)sulfonylamino]propanoate (PubChem CID 106270997) has the molecular formula C10H14N2O4S3 and a molecular weight of 322.43 g/mol. Its IUPAC name is ethyl 3-[(5-carbamothioylthiophen-2-yl)sulfonylamino]propanoate.
| Compound Name | ethyl 3-[(5-carbamothioylthiophen-2-yl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 106270997 |
| Molecular Formula | C10H14N2O4S3 |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | ethyl 3-[(5-carbamothioylthiophen-2-yl)sulfonylamino]propanoate |
| SMILES | CCOC(=O)CCNS(=O)(=O)c1ccc(C(N)=S)s1 |
| InChI | InChI=1S/C10H14N2O4S3/c1-2-16-8(13)5-6-12-19(14,15)9-4-3-7(18-9)10(11)17/h3-4,12H,2,5-6H2,1H3,(H2,11,17) |
| InChIKey | AXHBZRPYPBPIDA-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|