C9H13N3O4S3 — CID 106272189
2-[2-[(5-carbamothioylthiophen-2-yl)sulfonylamino]ethoxy]acetamide (PubChem CID 106272189) has the molecular formula C9H13N3O4S3 and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-[2-[(5-carbamothioylthiophen-2-yl)sulfonylamino]ethoxy]acetamide.
| Compound Name | 2-[2-[(5-carbamothioylthiophen-2-yl)sulfonylamino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106272189 |
| Molecular Formula | C9H13N3O4S3 |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 2-[2-[(5-carbamothioylthiophen-2-yl)sulfonylamino]ethoxy]acetamide |
| SMILES | NC(=O)COCCNS(=O)(=O)c1ccc(C(N)=S)s1 |
| InChI | InChI=1S/C9H13N3O4S3/c10-7(13)5-16-4-3-12-19(14,15)8-2-1-6(18-8)9(11)17/h1-2,12H,3-5H2,(H2,10,13)(H2,11,17) |
| InChIKey | FNSKLOXEBIQZQS-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|