C7H10ClN3O4S2 — CID 106235531
2-[2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]ethoxy]acetamide (PubChem CID 106235531) has the molecular formula C7H10ClN3O4S2 and a molecular weight of 299.76 g/mol. Its IUPAC name is 2-[2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]ethoxy]acetamide.
| Compound Name | 2-[2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106235531 |
| Molecular Formula | C7H10ClN3O4S2 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 2-[2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]ethoxy]acetamide |
| SMILES | NC(=O)COCCNS(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C7H10ClN3O4S2/c8-7-10-3-6(16-7)17(13,14)11-1-2-15-4-5(9)12/h3,11H,1-2,4H2,(H2,9,12) |
| InChIKey | VHKRWJFXIQSCNZ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|