C8H12N4O6S — CID 106234889
5-[2-(2-amino-2-oxoethoxy)ethylsulfamoyl]-1H-pyrazole-4-carboxylic acid (PubChem CID 106234889) has the molecular formula C8H12N4O6S and a molecular weight of 292.27 g/mol. Its IUPAC name is 5-[2-(2-amino-2-oxoethoxy)ethylsulfamoyl]-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-[2-(2-amino-2-oxoethoxy)ethylsulfamoyl]-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106234889 |
| Molecular Formula | C8H12N4O6S |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 5-[2-(2-amino-2-oxoethoxy)ethylsulfamoyl]-1H-pyrazole-4-carboxylic acid |
| SMILES | NC(=O)COCCNS(=O)(=O)c1[nH]ncc1C(=O)O |
| InChI | InChI=1S/C8H12N4O6S/c9-6(13)4-18-2-1-11-19(16,17)7-5(8(14)15)3-10-12-7/h3,11H,1-2,4H2,(H2,9,13)(H,10,12)(H,14,15) |
| InChIKey | FUOFCONVXQBFMP-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 164.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|