C8H13N5O4S — CID 106241017
2-[2-[(2-aminopyrimidin-5-yl)sulfonylamino]ethoxy]acetamide (PubChem CID 106241017) has the molecular formula C8H13N5O4S and a molecular weight of 275.29 g/mol. Its IUPAC name is 2-[2-[(2-aminopyrimidin-5-yl)sulfonylamino]ethoxy]acetamide.
| Compound Name | 2-[2-[(2-aminopyrimidin-5-yl)sulfonylamino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106241017 |
| Molecular Formula | C8H13N5O4S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 2-[2-[(2-aminopyrimidin-5-yl)sulfonylamino]ethoxy]acetamide |
| SMILES | NC(=O)COCCNS(=O)(=O)c1cnc(N)nc1 |
| InChI | InChI=1S/C8H13N5O4S/c9-7(14)5-17-2-1-13-18(15,16)6-3-11-8(10)12-4-6/h3-4,13H,1-2,5H2,(H2,9,14)(H2,10,11,12) |
| InChIKey | CBPWGTYBPDWFDC-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 150.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|