C7H12N4O4S2 — CID 62162959
2-amino-N-(2-methylsulfonylethyl)pyrimidine-5-sulfonamide (PubChem CID 62162959) has the molecular formula C7H12N4O4S2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-amino-N-(2-methylsulfonylethyl)pyrimidine-5-sulfonamide.
| Compound Name | 2-amino-N-(2-methylsulfonylethyl)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 62162959 |
| Molecular Formula | C7H12N4O4S2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-amino-N-(2-methylsulfonylethyl)pyrimidine-5-sulfonamide |
| SMILES | CS(=O)(=O)CCNS(=O)(=O)c1cnc(N)nc1 |
| InChI | InChI=1S/C7H12N4O4S2/c1-16(12,13)3-2-11-17(14,15)6-4-9-7(8)10-5-6/h4-5,11H,2-3H2,1H3,(H2,8,9,10) |
| InChIKey | XDQSTIJDKZIHGH-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |