C9H14ClN3O4S2 — CID 64602641
6-amino-5-chloro-N-(3-methylsulfonylpropyl)pyridine-3-sulfonamide (PubChem CID 64602641) has the molecular formula C9H14ClN3O4S2 and a molecular weight of 327.82 g/mol. Its IUPAC name is 6-amino-5-chloro-N-(3-methylsulfonylpropyl)pyridine-3-sulfonamide.
| Compound Name | 6-amino-5-chloro-N-(3-methylsulfonylpropyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64602641 |
| Molecular Formula | C9H14ClN3O4S2 |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 6-amino-5-chloro-N-(3-methylsulfonylpropyl)pyridine-3-sulfonamide |
| SMILES | CS(=O)(=O)CCCNS(=O)(=O)c1cnc(N)c(Cl)c1 |
| InChI | InChI=1S/C9H14ClN3O4S2/c1-18(14,15)4-2-3-13-19(16,17)7-5-8(10)9(11)12-6-7/h5-6,13H,2-4H2,1H3,(H2,11,12) |
| InChIKey | WUWHXBDREYLMQW-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|