C7H11ClN4O2S — CID 83023337
6-amino-5-chloro-N',N'-dimethylpyridine-3-sulfonohydrazide (PubChem CID 83023337) has the molecular formula C7H11ClN4O2S and a molecular weight of 250.71 g/mol. Its IUPAC name is 6-amino-5-chloro-N',N'-dimethylpyridine-3-sulfonohydrazide.
| Compound Name | 6-amino-5-chloro-N',N'-dimethylpyridine-3-sulfonohydrazide |
|---|---|
| PubChem CID | 83023337 |
| Molecular Formula | C7H11ClN4O2S |
| Molecular Weight | 250.71 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 6-amino-5-chloro-N',N'-dimethylpyridine-3-sulfonohydrazide |
| SMILES | CN(C)NS(=O)(=O)c1cnc(N)c(Cl)c1 |
| InChI | InChI=1S/C7H11ClN4O2S/c1-12(2)11-15(13,14)5-3-6(8)7(9)10-4-5/h3-4,11H,1-2H3,(H2,9,10) |
| InChIKey | VWVNEWNRIRFGHD-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.71 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|