C9H13ClN4O3S — CID 64601109
2-[(6-amino-5-chloro-3-pyridinyl)sulfonylamino]-2-methylpropanamide (PubChem CID 64601109) has the molecular formula C9H13ClN4O3S and a molecular weight of 292.75 g/mol. Its IUPAC name is 2-[(6-amino-5-chloro-3-pyridinyl)sulfonylamino]-2-methylpropanamide.
| Compound Name | 2-[(6-amino-5-chloro-3-pyridinyl)sulfonylamino]-2-methylpropanamide |
|---|---|
| PubChem CID | 64601109 |
| Molecular Formula | C9H13ClN4O3S |
| Molecular Weight | 292.75 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 2-[(6-amino-5-chloro-3-pyridinyl)sulfonylamino]-2-methylpropanamide |
| SMILES | CC(C)(NS(=O)(=O)c1cnc(N)c(Cl)c1)C(N)=O |
| InChI | InChI=1S/C9H13ClN4O3S/c1-9(2,8(12)15)14-18(16,17)5-3-6(10)7(11)13-4-5/h3-4,14H,1-2H3,(H2,11,13)(H2,12,15) |
| InChIKey | UYJKONYTBHBBKQ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.75 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |