C10H12N4O3S — CID 113229697
2-[(6-cyano-3-pyridinyl)sulfonylamino]-2-methylpropanamide (PubChem CID 113229697) has the molecular formula C10H12N4O3S and a molecular weight of 268.30 g/mol. Its IUPAC name is 2-[(6-cyano-3-pyridinyl)sulfonylamino]-2-methylpropanamide.
| Compound Name | 2-[(6-cyano-3-pyridinyl)sulfonylamino]-2-methylpropanamide |
|---|---|
| PubChem CID | 113229697 |
| Molecular Formula | C10H12N4O3S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2-[(6-cyano-3-pyridinyl)sulfonylamino]-2-methylpropanamide |
| SMILES | CC(C)(NS(=O)(=O)c1ccc(C#N)nc1)C(N)=O |
| InChI | InChI=1S/C10H12N4O3S/c1-10(2,9(12)15)14-18(16,17)8-4-3-7(5-11)13-6-8/h3-4,6,14H,1-2H3,(H2,12,15) |
| InChIKey | GKIHDTDMALIRBC-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 125.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |