C9H10N4O4S — CID 114153229
3-[(6-cyano-3-pyridinyl)sulfonylamino]-2-hydroxypropanamide (PubChem CID 114153229) has the molecular formula C9H10N4O4S and a molecular weight of 270.27 g/mol. Its IUPAC name is 3-[(6-cyano-3-pyridinyl)sulfonylamino]-2-hydroxypropanamide.
| Compound Name | 3-[(6-cyano-3-pyridinyl)sulfonylamino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 114153229 |
| Molecular Formula | C9H10N4O4S |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 3-[(6-cyano-3-pyridinyl)sulfonylamino]-2-hydroxypropanamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCC(O)C(N)=O)cn1 |
| InChI | InChI=1S/C9H10N4O4S/c10-3-6-1-2-7(4-12-6)18(16,17)13-5-8(14)9(11)15/h1-2,4,8,13-14H,5H2,(H2,11,15) |
| InChIKey | TYGJLQYANMIZNA-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 146.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |