C10H9N3O6S — CID 104935609
(2S)-2-[(6-cyano-3-pyridinyl)sulfonylamino]butanedioic acid (PubChem CID 104935609) has the molecular formula C10H9N3O6S and a molecular weight of 299.26 g/mol. Its IUPAC name is (2S)-2-[(6-cyano-3-pyridinyl)sulfonylamino]butanedioic acid.
| Compound Name | (2S)-2-[(6-cyano-3-pyridinyl)sulfonylamino]butanedioic acid |
|---|---|
| PubChem CID | 104935609 |
| Molecular Formula | C10H9N3O6S |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | (2S)-2-[(6-cyano-3-pyridinyl)sulfonylamino]butanedioic acid |
| SMILES | N#Cc1ccc(S(=O)(=O)N[C@@H](CC(=O)O)C(=O)O)cn1 |
| InChI | InChI=1S/C10H9N3O6S/c11-4-6-1-2-7(5-12-6)20(18,19)13-8(10(16)17)3-9(14)15/h1-2,5,8,13H,3H2,(H,14,15)(H,16,17)/t8-/m0/s1 |
| InChIKey | VEZZABJVYIOYLY-QMMMGPOBSA-N |
| XLogP | -0.84 |
| TPSA | 157.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |