C10H12N2O6S — CID 71945726
2-[(4-aminophenyl)sulfonylamino]butanedioic acid (PubChem CID 71945726) has the molecular formula C10H12N2O6S and a molecular weight of 288.28 g/mol. Its IUPAC name is 2-[(4-aminophenyl)sulfonylamino]butanedioic acid.
| Compound Name | 2-[(4-aminophenyl)sulfonylamino]butanedioic acid |
|---|---|
| PubChem CID | 71945726 |
| Molecular Formula | C10H12N2O6S |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2-[(4-aminophenyl)sulfonylamino]butanedioic acid |
| SMILES | Nc1ccc(S(=O)(=O)NC(CC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C10H12N2O6S/c11-6-1-3-7(4-2-6)19(17,18)12-8(10(15)16)5-9(13)14/h1-4,8,12H,5,11H2,(H,13,14)(H,15,16) |
| InChIKey | BILOYIQVPVFEST-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|