C8H11N3O6S — CID 113226185
(2S)-2-[(1-methylpyrazol-4-yl)sulfonylamino]butanedioic acid (PubChem CID 113226185) has the molecular formula C8H11N3O6S and a molecular weight of 277.26 g/mol. Its IUPAC name is (2S)-2-[(1-methylpyrazol-4-yl)sulfonylamino]butanedioic acid.
| Compound Name | (2S)-2-[(1-methylpyrazol-4-yl)sulfonylamino]butanedioic acid |
|---|---|
| PubChem CID | 113226185 |
| Molecular Formula | C8H11N3O6S |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | (2S)-2-[(1-methylpyrazol-4-yl)sulfonylamino]butanedioic acid |
| SMILES | Cn1cc(S(=O)(=O)N[C@@H](CC(=O)O)C(=O)O)cn1 |
| InChI | InChI=1S/C8H11N3O6S/c1-11-4-5(3-9-11)18(16,17)10-6(8(14)15)2-7(12)13/h3-4,6,10H,2H2,1H3,(H,12,13)(H,14,15)/t6-/m0/s1 |
| InChIKey | NNLWJMXKGIXNII-LURJTMIESA-N |
| XLogP | -1.37 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |