C8H13N3O4S — CID 43361171
4-[(1-methylpyrazol-4-yl)sulfonylamino]butanoic acid (PubChem CID 43361171) has the molecular formula C8H13N3O4S and a molecular weight of 247.28 g/mol. Its IUPAC name is 4-[(1-methylpyrazol-4-yl)sulfonylamino]butanoic acid.
| Compound Name | 4-[(1-methylpyrazol-4-yl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 43361171 |
| Molecular Formula | C8H13N3O4S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 4-[(1-methylpyrazol-4-yl)sulfonylamino]butanoic acid |
| SMILES | Cn1cc(S(=O)(=O)NCCCC(=O)O)cn1 |
| InChI | InChI=1S/C8H13N3O4S/c1-11-6-7(5-9-11)16(14,15)10-4-2-3-8(12)13/h5-6,10H,2-4H2,1H3,(H,12,13) |
| InChIKey | RFLABOCCTYHFFH-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|