C6H12N4O4S2 — CID 62063368
1-methyl-N-(2-sulfamoylethyl)pyrazole-4-sulfonamide (PubChem CID 62063368) has the molecular formula C6H12N4O4S2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 1-methyl-N-(2-sulfamoylethyl)pyrazole-4-sulfonamide.
| Compound Name | 1-methyl-N-(2-sulfamoylethyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 62063368 |
| Molecular Formula | C6H12N4O4S2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 1-methyl-N-(2-sulfamoylethyl)pyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NCCS(N)(=O)=O)cn1 |
| InChI | InChI=1S/C6H12N4O4S2/c1-10-5-6(4-8-10)16(13,14)9-2-3-15(7,11)12/h4-5,9H,2-3H2,1H3,(H2,7,11,12) |
| InChIKey | QURBICUXCIHDMW-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |